C12H25N5O3 — CID 118455345
3-(ethyliminomethylideneamino)-N,N-dimethylpropan-1-amine;N'-hydroxybutanediamide (PubChem CID 118455345) has the molecular formula C12H25N5O3 and a molecular weight of 287.36 g/mol. Its IUPAC name is 3-(ethyliminomethylideneamino)-N,N-dimethylpropan-1-amine;N'-hydroxybutanediamide.
| Compound Name | 3-(ethyliminomethylideneamino)-N,N-dimethylpropan-1-amine;N'-hydroxybutanediamide |
|---|---|
| PubChem CID | 118455345 |
| Molecular Formula | C12H25N5O3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | 3-(ethyliminomethylideneamino)-N,N-dimethylpropan-1-amine;N'-hydroxybutanediamide |
| SMILES | CCN=C=NCCCN(C)C.NC(=O)CCC(=O)NO |
| InChI | InChI=1S/C8H17N3.C4H8N2O3/c1-4-9-8-10-6-5-7-11(2)3;5-3(7)1-2-4(8)6-9/h4-7H2,1-3H3;9H,1-2H2,(H2,5,7)(H,6,8) |
| InChIKey | JUPWRTHBUPJZEJ-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 120.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|