C8H18AgClN3 — CID 174929426
3-(ethyliminomethylideneamino)-N,N-dimethylpropan-1-amine;silver;hydrochloride (PubChem CID 174929426) has the molecular formula C8H18AgClN3 and a molecular weight of 299.57 g/mol. Its IUPAC name is 3-(ethyliminomethylideneamino)-N,N-dimethylpropan-1-amine;silver;hydrochloride.
| Compound Name | 3-(ethyliminomethylideneamino)-N,N-dimethylpropan-1-amine;silver;hydrochloride |
|---|---|
| PubChem CID | 174929426 |
| Molecular Formula | C8H18AgClN3 |
| Molecular Weight | 299.57 g/mol |
| Exact Mass | 298.02 |
| IUPAC Name | 3-(ethyliminomethylideneamino)-N,N-dimethylpropan-1-amine;silver;hydrochloride |
| SMILES | CCN=C=NCCCN(C)C.Cl.[Ag] |
| InChI | InChI=1S/C8H17N3.Ag.ClH/c1-4-9-8-10-6-5-7-11(2)3;;/h4-7H2,1-3H3;;1H |
| InChIKey | WDKFTIGOESLLFE-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.57 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|