C10H22ClN3 — CID 87575427
ethene;3-(ethyliminomethylideneamino)-N,N-dimethylpropan-1-amine;hydrochloride (PubChem CID 87575427) has the molecular formula C10H22ClN3 and a molecular weight of 219.76 g/mol. Its IUPAC name is ethene;3-(ethyliminomethylideneamino)-N,N-dimethylpropan-1-amine;hydrochloride.
| Compound Name | ethene;3-(ethyliminomethylideneamino)-N,N-dimethylpropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 87575427 |
| Molecular Formula | C10H22ClN3 |
| Molecular Weight | 219.76 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | ethene;3-(ethyliminomethylideneamino)-N,N-dimethylpropan-1-amine;hydrochloride |
| SMILES | C=C.CCN=C=NCCCN(C)C.Cl |
| InChI | InChI=1S/C8H17N3.C2H4.ClH/c1-4-9-8-10-6-5-7-11(2)3;1-2;/h4-7H2,1-3H3;1-2H2;1H |
| InChIKey | URXQFBBNBPKWAF-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.76 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|