C11H23N3O — CID 158337348
3-(ethyliminomethylideneamino)-N,N-dimethylpropan-1-amine;propan-2-one (PubChem CID 158337348) has the molecular formula C11H23N3O and a molecular weight of 213.32 g/mol. Its IUPAC name is 3-(ethyliminomethylideneamino)-N,N-dimethylpropan-1-amine;propan-2-one.
| Compound Name | 3-(ethyliminomethylideneamino)-N,N-dimethylpropan-1-amine;propan-2-one |
|---|---|
| PubChem CID | 158337348 |
| Molecular Formula | C11H23N3O |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.18 |
| IUPAC Name | 3-(ethyliminomethylideneamino)-N,N-dimethylpropan-1-amine;propan-2-one |
| SMILES | CC(C)=O.CCN=C=NCCCN(C)C |
| InChI | InChI=1S/C8H17N3.C3H6O/c1-4-9-8-10-6-5-7-11(2)3;1-3(2)4/h4-7H2,1-3H3;1-2H3 |
| InChIKey | GQTAELFPTDMIBE-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 45.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|