C8H20N4 — CID 146446789
azane;3-(ethyliminomethylideneamino)-N,N-dimethylpropan-1-amine (PubChem CID 146446789) has the molecular formula C8H20N4 and a molecular weight of 172.28 g/mol. Its IUPAC name is azane;3-(ethyliminomethylideneamino)-N,N-dimethylpropan-1-amine.
| Compound Name | azane;3-(ethyliminomethylideneamino)-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 146446789 |
| Molecular Formula | C8H20N4 |
| Molecular Weight | 172.28 g/mol |
| Exact Mass | 172.17 |
| IUPAC Name | azane;3-(ethyliminomethylideneamino)-N,N-dimethylpropan-1-amine |
| SMILES | CCN=C=NCCCN(C)C.N |
| InChI | InChI=1S/C8H17N3.H3N/c1-4-9-8-10-6-5-7-11(2)3;/h4-7H2,1-3H3;1H3 |
| InChIKey | GIJBPUFMOPUIIA-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 62.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.28 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|