C16H34N6 — CID 158191301
3-(ethyliminomethylideneamino)-N,N-dimethylpropan-1-amine;3-(iminomethylideneamino)-N,N-dimethylpentan-1-amine (PubChem CID 158191301) has the molecular formula C16H34N6 and a molecular weight of 310.49 g/mol. Its IUPAC name is 3-(ethyliminomethylideneamino)-N,N-dimethylpropan-1-amine;3-(iminomethylideneamino)-N,N-dimethylpentan-1-amine.
| Compound Name | 3-(ethyliminomethylideneamino)-N,N-dimethylpropan-1-amine;3-(iminomethylideneamino)-N,N-dimethylpentan-1-amine |
|---|---|
| PubChem CID | 158191301 |
| Molecular Formula | C16H34N6 |
| Molecular Weight | 310.49 g/mol |
| Exact Mass | 310.28 |
| IUPAC Name | 3-(ethyliminomethylideneamino)-N,N-dimethylpropan-1-amine;3-(iminomethylideneamino)-N,N-dimethylpentan-1-amine |
| SMILES | CCC(CCN(C)C)N=C=N.CCN=C=NCCCN(C)C |
| InChI | InChI=1S/2C8H17N3/c1-4-8(10-7-9)5-6-11(2)3;1-4-9-8-10-6-5-7-11(2)3/h8-9H,4-6H2,1-3H3;4-7H2,1-3H3 |
| InChIKey | FZUBTGQFZZJSTE-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 67.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.49 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|