C10H21N3 — CID 87182255
N,N-diethyl-3-(iminomethylideneamino)pentan-1-amine (PubChem CID 87182255) has the molecular formula C10H21N3 and a molecular weight of 183.30 g/mol. Its IUPAC name is N,N-diethyl-3-(iminomethylideneamino)pentan-1-amine.
| Compound Name | N,N-diethyl-3-(iminomethylideneamino)pentan-1-amine |
|---|---|
| PubChem CID | 87182255 |
| Molecular Formula | C10H21N3 |
| Molecular Weight | 183.30 g/mol |
| Exact Mass | 183.17 |
| IUPAC Name | N,N-diethyl-3-(iminomethylideneamino)pentan-1-amine |
| SMILES | CCC(CCN(CC)CC)N=C=N |
| InChI | InChI=1S/C10H21N3/c1-4-10(12-9-11)7-8-13(5-2)6-3/h10-11H,4-8H2,1-3H3 |
| InChIKey | DUFVZZXHHWLHCV-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 39.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.30 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|