About 3,7-diisocyanatononane
3,7-diisocyanatononane (PubChem CID 146172232) has the molecular formula C11H18N2O2
and a molecular weight of 210.28 g/mol. Its IUPAC name is 3,7-diisocyanatononane.
Molecular Properties
| Compound Name | 3,7-diisocyanatononane |
| PubChem CID | 146172232 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 3,7-diisocyanatononane |
| SMILES | CCC(CCCC(CC)N=C=O)N=C=O |
| InChI | InChI=1S/C11H18N2O2/c1-3-10(12-8-14)6-5-7-11(4-2)13-9-15/h10-11H,3-7H2,1-2H3 |
| InChIKey | GCUIQNBBDVVXJF-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 3,7-diisocyanatononane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,7-diisocyanatononane?
The IUPAC name of 3,7-diisocyanatononane (CID 146172232) is 3,7-diisocyanatononane.
What is the SMILES notation for 3,7-diisocyanatononane?
The canonical SMILES for 3,7-diisocyanatononane is CCC(CCCC(CC)N=C=O)N=C=O.
What is the InChIKey of 3,7-diisocyanatononane?
The InChIKey is GCUIQNBBDVVXJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O2/c1-3-10(12-8-14)6-5-7-11(4-2)13-9-15/h10-11H,3-7H2,1-2H3.
What are the key properties of 3,7-diisocyanatononane?
3,7-diisocyanatononane has a molecular weight of 210.28 g/mol, XLogP of 2.39, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,7-diisocyanatononane is sourced from PubChem (CID 146172232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).