About (7S)-1,7-diisocyanatoundecane
(7S)-1,7-diisocyanatoundecane (PubChem CID 89383286) has the molecular formula C13H22N2O2
and a molecular weight of 238.33 g/mol. Its IUPAC name is (7S)-1,7-diisocyanatoundecane.
Molecular Properties
| Compound Name | (7S)-1,7-diisocyanatoundecane |
| PubChem CID | 89383286 |
| Molecular Formula | C13H22N2O2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | (7S)-1,7-diisocyanatoundecane |
| SMILES | CCCC[C@@H](CCCCCCN=C=O)N=C=O |
| InChI | InChI=1S/C13H22N2O2/c1-2-3-8-13(15-12-17)9-6-4-5-7-10-14-11-16/h13H,2-10H2,1H3/t13-/m0/s1 |
| InChIKey | MZYSUMYIJFTVGX-ZDUSSCGKSA-N |
| XLogP | 3.17 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze (7S)-1,7-diisocyanatoundecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7S)-1,7-diisocyanatoundecane?
The IUPAC name of (7S)-1,7-diisocyanatoundecane (CID 89383286) is (7S)-1,7-diisocyanatoundecane.
What is the SMILES notation for (7S)-1,7-diisocyanatoundecane?
The canonical SMILES for (7S)-1,7-diisocyanatoundecane is CCCC[C@@H](CCCCCCN=C=O)N=C=O.
What is the InChIKey of (7S)-1,7-diisocyanatoundecane?
The InChIKey is MZYSUMYIJFTVGX-ZDUSSCGKSA-N. The full InChI is InChI=1S/C13H22N2O2/c1-2-3-8-13(15-12-17)9-6-4-5-7-10-14-11-16/h13H,2-10H2,1H3/t13-/m0/s1.
What are the key properties of (7S)-1,7-diisocyanatoundecane?
(7S)-1,7-diisocyanatoundecane has a molecular weight of 238.33 g/mol, XLogP of 3.17, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (7S)-1,7-diisocyanatoundecane is sourced from PubChem (CID 89383286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).