C8H9N3O3 — CID 134346461
1,1,5-triisocyanatopentane (PubChem CID 134346461) has the molecular formula C8H9N3O3 and a molecular weight of 195.18 g/mol. Its IUPAC name is 1,1,5-triisocyanatopentane.
| Compound Name | 1,1,5-triisocyanatopentane |
|---|---|
| PubChem CID | 134346461 |
| Molecular Formula | C8H9N3O3 |
| Molecular Weight | 195.18 g/mol |
| Exact Mass | 195.06 |
| IUPAC Name | 1,1,5-triisocyanatopentane |
| SMILES | O=C=NCCCCC(N=C=O)N=C=O |
| InChI | InChI=1S/C8H9N3O3/c12-5-9-4-2-1-3-8(10-6-13)11-7-14/h8H,1-4H2 |
| InChIKey | MXXOFZAXBYNIEJ-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 88.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.18 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|