C16H22N4O4S — CID 57263337
1-(1,6-diisocyanatohexylsulfanyl)-1,6-diisocyanatohexane (PubChem CID 57263337) has the molecular formula C16H22N4O4S and a molecular weight of 366.44 g/mol. Its IUPAC name is 1-(1,6-diisocyanatohexylsulfanyl)-1,6-diisocyanatohexane.
| Compound Name | 1-(1,6-diisocyanatohexylsulfanyl)-1,6-diisocyanatohexane |
|---|---|
| PubChem CID | 57263337 |
| Molecular Formula | C16H22N4O4S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | 1-(1,6-diisocyanatohexylsulfanyl)-1,6-diisocyanatohexane |
| SMILES | O=C=NCCCCCC(N=C=O)SC(CCCCCN=C=O)N=C=O |
| InChI | InChI=1S/C16H22N4O4S/c21-11-17-9-5-1-3-7-15(19-13-23)25-16(20-14-24)8-4-2-6-10-18-12-22/h15-16H,1-10H2 |
| InChIKey | ICRYCZUYWSXNMF-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 117.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|