C10H14F2N2O2 — CID 89251387
2,3-difluoro-1,8-diisocyanatooctane (PubChem CID 89251387) has the molecular formula C10H14F2N2O2 and a molecular weight of 232.23 g/mol. Its IUPAC name is 2,3-difluoro-1,8-diisocyanatooctane.
| Compound Name | 2,3-difluoro-1,8-diisocyanatooctane |
|---|---|
| PubChem CID | 89251387 |
| Molecular Formula | C10H14F2N2O2 |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | 2,3-difluoro-1,8-diisocyanatooctane |
| SMILES | O=C=NCCCCCC(F)C(F)CN=C=O |
| InChI | InChI=1S/C10H14F2N2O2/c11-9(10(12)6-14-8-16)4-2-1-3-5-13-7-15/h9-10H,1-6H2 |
| InChIKey | LRTHXEFQXXNVIR-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|