C12H13F3N4O4 — CID 160860673
2,3-difluoro-1,4-diisocyanatobutane;2-fluoro-1,4-diisocyanatobutane (PubChem CID 160860673) has the molecular formula C12H13F3N4O4 and a molecular weight of 334.25 g/mol. Its IUPAC name is 2,3-difluoro-1,4-diisocyanatobutane;2-fluoro-1,4-diisocyanatobutane.
| Compound Name | 2,3-difluoro-1,4-diisocyanatobutane;2-fluoro-1,4-diisocyanatobutane |
|---|---|
| PubChem CID | 160860673 |
| Molecular Formula | C12H13F3N4O4 |
| Molecular Weight | 334.25 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | 2,3-difluoro-1,4-diisocyanatobutane;2-fluoro-1,4-diisocyanatobutane |
| SMILES | O=C=NCC(F)C(F)CN=C=O.O=C=NCCC(F)CN=C=O |
| InChI | InChI=1S/C6H6F2N2O2.C6H7FN2O2/c7-5(1-9-3-11)6(8)2-10-4-12;7-6(3-9-5-11)1-2-8-4-10/h5-6H,1-2H2;6H,1-3H2 |
| InChIKey | SKLBAIDYDMECPG-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 117.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.25 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|