About 3-ethyl-1,5-diisocyanatopentane
3-ethyl-1,5-diisocyanatopentane (PubChem CID 18990756) has the molecular formula C9H14N2O2
and a molecular weight of 182.22 g/mol. Its IUPAC name is 3-ethyl-1,5-diisocyanatopentane.
Molecular Properties
| Compound Name | 3-ethyl-1,5-diisocyanatopentane |
| PubChem CID | 18990756 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 3-ethyl-1,5-diisocyanatopentane |
| SMILES | CCC(CCN=C=O)CCN=C=O |
| InChI | InChI=1S/C9H14N2O2/c1-2-9(3-5-10-7-12)4-6-11-8-13/h9H,2-6H2,1H3 |
| InChIKey | HANVTIZWNMGDQE-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-1,5-diisocyanatopentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-1,5-diisocyanatopentane?
The IUPAC name of 3-ethyl-1,5-diisocyanatopentane (CID 18990756) is 3-ethyl-1,5-diisocyanatopentane.
What is the SMILES notation for 3-ethyl-1,5-diisocyanatopentane?
The canonical SMILES for 3-ethyl-1,5-diisocyanatopentane is CCC(CCN=C=O)CCN=C=O.
What is the InChIKey of 3-ethyl-1,5-diisocyanatopentane?
The InChIKey is HANVTIZWNMGDQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O2/c1-2-9(3-5-10-7-12)4-6-11-8-13/h9H,2-6H2,1H3.
What are the key properties of 3-ethyl-1,5-diisocyanatopentane?
3-ethyl-1,5-diisocyanatopentane has a molecular weight of 182.22 g/mol, XLogP of 1.46, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-1,5-diisocyanatopentane is sourced from PubChem (CID 18990756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).