C27H50N2O2 — CID 57192790
10-ethyl-1,20-diisocyanato-11-propylicosane (PubChem CID 57192790) has the molecular formula C27H50N2O2 and a molecular weight of 434.71 g/mol. Its IUPAC name is 10-ethyl-1,20-diisocyanato-11-propylicosane.
| Compound Name | 10-ethyl-1,20-diisocyanato-11-propylicosane |
|---|---|
| PubChem CID | 57192790 |
| Molecular Formula | C27H50N2O2 |
| Molecular Weight | 434.71 g/mol |
| Exact Mass | 434.39 |
| IUPAC Name | 10-ethyl-1,20-diisocyanato-11-propylicosane |
| SMILES | CCCC(CCCCCCCCCN=C=O)C(CC)CCCCCCCCCN=C=O |
| InChI | InChI=1S/C27H50N2O2/c1-3-19-27(21-16-12-8-6-10-14-18-23-29-25-31)26(4-2)20-15-11-7-5-9-13-17-22-28-24-30/h26-27H,3-23H2,1-2H3 |
| InChIKey | BKCHVGZFIYRWQD-UHFFFAOYSA-N |
| XLogP | 8.34 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.71 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|