About 1,8-diisocyanato-4-(isocyanatomethyl)octane;1-isocyanatononane
1,8-diisocyanato-4-(isocyanatomethyl)octane;1-isocyanatononane (PubChem CID 18694582) has the molecular formula C22H36N4O4
and a molecular weight of 420.55 g/mol. Its IUPAC name is 1,8-diisocyanato-4-(isocyanatomethyl)octane;1-isocyanatononane.
Molecular Properties
| Compound Name | 1,8-diisocyanato-4-(isocyanatomethyl)octane;1-isocyanatononane |
| PubChem CID | 18694582 |
| Molecular Formula | C22H36N4O4 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.27 |
| IUPAC Name | 1,8-diisocyanato-4-(isocyanatomethyl)octane;1-isocyanatononane |
| SMILES | CCCCCCCCCN=C=O.O=C=NCCCCC(CCCN=C=O)CN=C=O |
| InChI | InChI=1S/C12H17N3O3.C10H19NO/c16-9-13-6-2-1-4-12(8-15-11-18)5-3-7-14-10-17;1-2-3-4-5-6-7-8-9-11-10-12/h12H,1-8H2;2-9H2,1H3 |
| InChIKey | IXINJIVYRRPYCP-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 117.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 1,8-diisocyanato-4-(isocyanatomethyl)octane;1-isocyanatononane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,8-diisocyanato-4-(isocyanatomethyl)octane;1-isocyanatononane?
The IUPAC name of 1,8-diisocyanato-4-(isocyanatomethyl)octane;1-isocyanatononane (CID 18694582) is 1,8-diisocyanato-4-(isocyanatomethyl)octane;1-isocyanatononane.
What is the SMILES notation for 1,8-diisocyanato-4-(isocyanatomethyl)octane;1-isocyanatononane?
The canonical SMILES for 1,8-diisocyanato-4-(isocyanatomethyl)octane;1-isocyanatononane is CCCCCCCCCN=C=O.O=C=NCCCCC(CCCN=C=O)CN=C=O.
What is the InChIKey of 1,8-diisocyanato-4-(isocyanatomethyl)octane;1-isocyanatononane?
The InChIKey is IXINJIVYRRPYCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3O3.C10H19NO/c16-9-13-6-2-1-4-12(8-15-11-18)5-3-7-14-10-17;1-2-3-4-5-6-7-8-9-11-10-12/h12H,1-8H2;2-9H2,1H3.
What are the key properties of 1,8-diisocyanato-4-(isocyanatomethyl)octane;1-isocyanatononane?
1,8-diisocyanato-4-(isocyanatomethyl)octane;1-isocyanatononane has a molecular weight of 420.55 g/mol, XLogP of 4.63, 19 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1,8-diisocyanato-4-(isocyanatomethyl)octane;1-isocyanatononane is sourced from PubChem (CID 18694582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).