C7H11F2NO — CID 151804401
3,4-difluoro-1-isocyanatohexane (PubChem CID 151804401) has the molecular formula C7H11F2NO and a molecular weight of 163.17 g/mol. Its IUPAC name is 3,4-difluoro-1-isocyanatohexane.
| Compound Name | 3,4-difluoro-1-isocyanatohexane |
|---|---|
| PubChem CID | 151804401 |
| Molecular Formula | C7H11F2NO |
| Molecular Weight | 163.17 g/mol |
| Exact Mass | 163.08 |
| IUPAC Name | 3,4-difluoro-1-isocyanatohexane |
| SMILES | CCC(F)C(F)CCN=C=O |
| InChI | InChI=1S/C7H11F2NO/c1-2-6(8)7(9)3-4-10-5-11/h6-7H,2-4H2,1H3 |
| InChIKey | RZHKGSGYGBUUTO-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.17 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|