About 1-isocyanatobutan-2-ol
1-isocyanatobutan-2-ol (PubChem CID 20685313) has the molecular formula C5H9NO2
and a molecular weight of 115.13 g/mol. Its IUPAC name is 1-isocyanatobutan-2-ol.
Molecular Properties
| Compound Name | 1-isocyanatobutan-2-ol |
| PubChem CID | 20685313 |
| Molecular Formula | C5H9NO2 |
| Molecular Weight | 115.13 g/mol |
| Exact Mass | 115.06 |
| IUPAC Name | 1-isocyanatobutan-2-ol |
| SMILES | CCC(O)CN=C=O |
| InChI | InChI=1S/C5H9NO2/c1-2-5(8)3-6-4-7/h5,8H,2-3H2,1H3 |
| InChIKey | QFBVXZSYFCARLL-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.13 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 1-isocyanatobutan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-isocyanatobutan-2-ol?
The IUPAC name of 1-isocyanatobutan-2-ol (CID 20685313) is 1-isocyanatobutan-2-ol.
What is the SMILES notation for 1-isocyanatobutan-2-ol?
The canonical SMILES for 1-isocyanatobutan-2-ol is CCC(O)CN=C=O.
What is the InChIKey of 1-isocyanatobutan-2-ol?
The InChIKey is QFBVXZSYFCARLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO2/c1-2-5(8)3-6-4-7/h5,8H,2-3H2,1H3.
What are the key properties of 1-isocyanatobutan-2-ol?
1-isocyanatobutan-2-ol has a molecular weight of 115.13 g/mol, XLogP of 0.09, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-isocyanatobutan-2-ol is sourced from PubChem (CID 20685313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).