C10H10N4O4 — CID 91150908
1,2,3,6-tetraisocyanatohexane (PubChem CID 91150908) has the molecular formula C10H10N4O4 and a molecular weight of 250.21 g/mol. Its IUPAC name is 1,2,3,6-tetraisocyanatohexane.
| Compound Name | 1,2,3,6-tetraisocyanatohexane |
|---|---|
| PubChem CID | 91150908 |
| Molecular Formula | C10H10N4O4 |
| Molecular Weight | 250.21 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | 1,2,3,6-tetraisocyanatohexane |
| SMILES | O=C=NCCCC(N=C=O)C(CN=C=O)N=C=O |
| InChI | InChI=1S/C10H10N4O4/c15-5-11-3-1-2-9(13-7-17)10(14-8-18)4-12-6-16/h9-10H,1-4H2 |
| InChIKey | YWQPLVNFMNXAHS-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 117.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.21 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|