C20H30N4O4 — CID 175031449
1,4,5,7-tetraisocyanato-6,8,9,10,10-pentamethylundecane (PubChem CID 175031449) has the molecular formula C20H30N4O4 and a molecular weight of 390.48 g/mol. Its IUPAC name is 1,4,5,7-tetraisocyanato-6,8,9,10,10-pentamethylundecane.
| Compound Name | 1,4,5,7-tetraisocyanato-6,8,9,10,10-pentamethylundecane |
|---|---|
| PubChem CID | 175031449 |
| Molecular Formula | C20H30N4O4 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | 1,4,5,7-tetraisocyanato-6,8,9,10,10-pentamethylundecane |
| SMILES | CC(C(N=C=O)C(CCCN=C=O)N=C=O)C(N=C=O)C(C)C(C)C(C)(C)C |
| InChI | InChI=1S/C20H30N4O4/c1-14(16(3)20(4,5)6)18(23-12-27)15(2)19(24-13-28)17(22-11-26)8-7-9-21-10-25/h14-19H,7-9H2,1-6H3 |
| InChIKey | SKXLJFUSVCAIKO-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 117.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|