C21H36N2O2 — CID 88776266
9,19-diisocyanatononadec-1-ene (PubChem CID 88776266) has the molecular formula C21H36N2O2 and a molecular weight of 348.53 g/mol. Its IUPAC name is 9,19-diisocyanatononadec-1-ene.
| Compound Name | 9,19-diisocyanatononadec-1-ene |
|---|---|
| PubChem CID | 88776266 |
| Molecular Formula | C21H36N2O2 |
| Molecular Weight | 348.53 g/mol |
| Exact Mass | 348.28 |
| IUPAC Name | 9,19-diisocyanatononadec-1-ene |
| SMILES | C=CCCCCCCC(CCCCCCCCCCN=C=O)N=C=O |
| InChI | InChI=1S/C21H36N2O2/c1-2-3-4-5-10-13-16-21(23-20-25)17-14-11-8-6-7-9-12-15-18-22-19-24/h2,21H,1,3-18H2 |
| InChIKey | BGNOWKZICKJUQI-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.53 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|