About 2-hydroxyethyl 4,9-diisocyanato-2-methylidenenonanoate
2-hydroxyethyl 4,9-diisocyanato-2-methylidenenonanoate (PubChem CID 91384616) has the molecular formula C14H20N2O5
and a molecular weight of 296.32 g/mol. Its IUPAC name is 2-hydroxyethyl 4,9-diisocyanato-2-methylidenenonanoate.
Molecular Properties
| Compound Name | 2-hydroxyethyl 4,9-diisocyanato-2-methylidenenonanoate |
| PubChem CID | 91384616 |
| Molecular Formula | C14H20N2O5 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 2-hydroxyethyl 4,9-diisocyanato-2-methylidenenonanoate |
| SMILES | C=C(CC(CCCCCN=C=O)N=C=O)C(=O)OCCO |
| InChI | InChI=1S/C14H20N2O5/c1-12(14(20)21-8-7-17)9-13(16-11-19)5-3-2-4-6-15-10-18/h13,17H,1-9H2 |
| InChIKey | RORVIGSBWFPGLG-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxyethyl 4,9-diisocyanato-2-methylidenenonanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyethyl 4,9-diisocyanato-2-methylidenenonanoate?
The IUPAC name of 2-hydroxyethyl 4,9-diisocyanato-2-methylidenenonanoate (CID 91384616) is 2-hydroxyethyl 4,9-diisocyanato-2-methylidenenonanoate.
What is the SMILES notation for 2-hydroxyethyl 4,9-diisocyanato-2-methylidenenonanoate?
The canonical SMILES for 2-hydroxyethyl 4,9-diisocyanato-2-methylidenenonanoate is C=C(CC(CCCCCN=C=O)N=C=O)C(=O)OCCO.
What is the InChIKey of 2-hydroxyethyl 4,9-diisocyanato-2-methylidenenonanoate?
The InChIKey is RORVIGSBWFPGLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2O5/c1-12(14(20)21-8-7-17)9-13(16-11-19)5-3-2-4-6-15-10-18/h13,17H,1-9H2.
What are the key properties of 2-hydroxyethyl 4,9-diisocyanato-2-methylidenenonanoate?
2-hydroxyethyl 4,9-diisocyanato-2-methylidenenonanoate has a molecular weight of 296.32 g/mol, XLogP of 1.07, 12 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyethyl 4,9-diisocyanato-2-methylidenenonanoate is sourced from PubChem (CID 91384616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).