C14H20N4O5 — CID 20603651
2-(prop-2-enylcarbamoylamino)ethyl 2,6-diisocyanatohexanoate (PubChem CID 20603651) has the molecular formula C14H20N4O5 and a molecular weight of 324.34 g/mol. Its IUPAC name is 2-(prop-2-enylcarbamoylamino)ethyl 2,6-diisocyanatohexanoate.
| Compound Name | 2-(prop-2-enylcarbamoylamino)ethyl 2,6-diisocyanatohexanoate |
|---|---|
| PubChem CID | 20603651 |
| Molecular Formula | C14H20N4O5 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 2-(prop-2-enylcarbamoylamino)ethyl 2,6-diisocyanatohexanoate |
| SMILES | C=CCNC(=O)NCCOC(=O)C(CCCCN=C=O)N=C=O |
| InChI | InChI=1S/C14H20N4O5/c1-2-6-16-14(22)17-8-9-23-13(21)12(18-11-20)5-3-4-7-15-10-19/h2,12H,1,3-9H2,(H2,16,17,22) |
| InChIKey | BJIOKLVOGQHLKT-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 126.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|