C17H26N4O6S — CID 58986416
2-[3-(3-amino-2-methyl-3-oxopropyl)sulfanylpropanoylamino]ethyl 2,6-diisocyanatohexanoate (PubChem CID 58986416) has the molecular formula C17H26N4O6S and a molecular weight of 414.48 g/mol. Its IUPAC name is 2-[3-(3-amino-2-methyl-3-oxopropyl)sulfanylpropanoylamino]ethyl 2,6-diisocyanatohexanoate.
| Compound Name | 2-[3-(3-amino-2-methyl-3-oxopropyl)sulfanylpropanoylamino]ethyl 2,6-diisocyanatohexanoate |
|---|---|
| PubChem CID | 58986416 |
| Molecular Formula | C17H26N4O6S |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | 2-[3-(3-amino-2-methyl-3-oxopropyl)sulfanylpropanoylamino]ethyl 2,6-diisocyanatohexanoate |
| SMILES | CC(CSCCC(=O)NCCOC(=O)C(CCCCN=C=O)N=C=O)C(N)=O |
| InChI | InChI=1S/C17H26N4O6S/c1-13(16(18)25)10-28-9-5-15(24)20-7-8-27-17(26)14(21-12-23)4-2-3-6-19-11-22/h13-14H,2-10H2,1H3,(H2,18,25)(H,20,24) |
| InChIKey | RZYWFERDRJNYER-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 157.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|