C24H39N3O10 — CID 91198452
2-[1-[3-[2-(1-hydroxy-2-methylprop-2-enoxy)propoxy]propoxy]propan-2-yloxycarbonylamino]ethyl 2,6-diisocyanatohexanoate (PubChem CID 91198452) has the molecular formula C24H39N3O10 and a molecular weight of 529.59 g/mol. Its IUPAC name is 2-[1-[3-[2-(1-hydroxy-2-methylprop-2-enoxy)propoxy]propoxy]propan-2-yloxycarbonylamino]ethyl 2,6-diisocyanatohexanoate.
| Compound Name | 2-[1-[3-[2-(1-hydroxy-2-methylprop-2-enoxy)propoxy]propoxy]propan-2-yloxycarbonylamino]ethyl 2,6-diisocyanatohexanoate |
|---|---|
| PubChem CID | 91198452 |
| Molecular Formula | C24H39N3O10 |
| Molecular Weight | 529.59 g/mol |
| Exact Mass | 529.26 |
| IUPAC Name | 2-[1-[3-[2-(1-hydroxy-2-methylprop-2-enoxy)propoxy]propoxy]propan-2-yloxycarbonylamino]ethyl 2,6-diisocyanatohexanoate |
| SMILES | C=C(C)C(O)OC(C)COCCCOCC(C)OC(=O)NCCOC(=O)C(CCCCN=C=O)N=C=O |
| InChI | InChI=1S/C24H39N3O10/c1-18(2)22(30)36-19(3)14-33-11-7-12-34-15-20(4)37-24(32)26-10-13-35-23(31)21(27-17-29)8-5-6-9-25-16-28/h19-22,30H,1,5-15H2,2-4H3,(H,26,32) |
| InChIKey | JGPGJRAVTUHVEK-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 171.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.59 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|