C16H26N4O7S — CID 89217146
2-[(3-amino-3-hydroxy-2-methylpropyl)sulfanylmethoxycarbonylamino]ethyl 2,6-diisocyanatohexanoate (PubChem CID 89217146) has the molecular formula C16H26N4O7S and a molecular weight of 418.47 g/mol. Its IUPAC name is 2-[(3-amino-3-hydroxy-2-methylpropyl)sulfanylmethoxycarbonylamino]ethyl 2,6-diisocyanatohexanoate.
| Compound Name | 2-[(3-amino-3-hydroxy-2-methylpropyl)sulfanylmethoxycarbonylamino]ethyl 2,6-diisocyanatohexanoate |
|---|---|
| PubChem CID | 89217146 |
| Molecular Formula | C16H26N4O7S |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | 2-[(3-amino-3-hydroxy-2-methylpropyl)sulfanylmethoxycarbonylamino]ethyl 2,6-diisocyanatohexanoate |
| SMILES | CC(CSCOC(=O)NCCOC(=O)C(CCCCN=C=O)N=C=O)C(N)O |
| InChI | InChI=1S/C16H26N4O7S/c1-12(14(17)23)8-28-11-27-16(25)19-6-7-26-15(24)13(20-10-22)4-2-3-5-18-9-21/h12-14,23H,2-8,11,17H2,1H3,(H,19,25) |
| InChIKey | WBXHVGJSEBCDAI-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 169.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|