C29H46N6O12S2 — CID 129100124
2-isocyanatoethyl 6-[2-[2-[2-[[6-[2-[hydroxy(methyl)amino]ethoxy]-5-isocyanato-6-oxohexyl]carbamoyloxy]ethylsulfanyl]propan-2-ylsulfanyl]ethoxycarbonylamino]-2-isocyanatohexanoate (PubChem CID 129100124) has the molecular formula C29H46N6O12S2 and a molecular weight of 734.85 g/mol. Its IUPAC name is 2-isocyanatoethyl 6-[2-[2-[2-[[6-[2-[hydroxy(methyl)amino]ethoxy]-5-isocyanato-6-oxohexyl]carbamoyloxy]ethylsulfanyl]propan-2-ylsulfanyl]ethoxycarbonylamino]-2-isocyanatohexanoate.
| Compound Name | 2-isocyanatoethyl 6-[2-[2-[2-[[6-[2-[hydroxy(methyl)amino]ethoxy]-5-isocyanato-6-oxohexyl]carbamoyloxy]ethylsulfanyl]propan-2-ylsulfanyl]ethoxycarbonylamino]-2-isocyanatohexanoate |
|---|---|
| PubChem CID | 129100124 |
| Molecular Formula | C29H46N6O12S2 |
| Molecular Weight | 734.85 g/mol |
| Exact Mass | 734.26 |
| IUPAC Name | 2-isocyanatoethyl 6-[2-[2-[2-[[6-[2-[hydroxy(methyl)amino]ethoxy]-5-isocyanato-6-oxohexyl]carbamoyloxy]ethylsulfanyl]propan-2-ylsulfanyl]ethoxycarbonylamino]-2-isocyanatohexanoate |
| SMILES | CN(O)CCOC(=O)C(CCCCNC(=O)OCCSC(C)(C)SCCOC(=O)NCCCCC(N=C=O)C(=O)OCCN=C=O)N=C=O |
| InChI | InChI=1S/C29H46N6O12S2/c1-29(2,48-18-16-46-27(41)31-10-6-4-8-23(33-21-37)25(39)44-14-12-30-20-36)49-19-17-47-28(42)32-11-7-5-9-24(34-22-38)26(40)45-15-13-35(3)43/h23-24,43H,4-19H2,1-3H3,(H,31,41)(H,32,42) |
| InChIKey | PIWZDFQHPJLNOX-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 241.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.85 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|