C9H16N2O3 — CID 88633869
ethyl N-(5-isocyanatopentyl)carbamate (PubChem CID 88633869) has the molecular formula C9H16N2O3 and a molecular weight of 200.24 g/mol. Its IUPAC name is ethyl N-(5-isocyanatopentyl)carbamate.
| Compound Name | ethyl N-(5-isocyanatopentyl)carbamate |
|---|---|
| PubChem CID | 88633869 |
| Molecular Formula | C9H16N2O3 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | ethyl N-(5-isocyanatopentyl)carbamate |
| SMILES | CCOC(=O)NCCCCCN=C=O |
| InChI | InChI=1S/C9H16N2O3/c1-2-14-9(13)11-7-5-3-4-6-10-8-12/h2-7H2,1H3,(H,11,13) |
| InChIKey | BZZSOEBEYINRFU-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|