C19H31N5O6 — CID 161037647
methyl N-[6-[[8-isocyanato-2-(isocyanatocarbamoyl)octanoyl]amino]hexyl]carbamate (PubChem CID 161037647) has the molecular formula C19H31N5O6 and a molecular weight of 425.49 g/mol. Its IUPAC name is methyl N-[6-[[8-isocyanato-2-(isocyanatocarbamoyl)octanoyl]amino]hexyl]carbamate.
| Compound Name | methyl N-[6-[[8-isocyanato-2-(isocyanatocarbamoyl)octanoyl]amino]hexyl]carbamate |
|---|---|
| PubChem CID | 161037647 |
| Molecular Formula | C19H31N5O6 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | methyl N-[6-[[8-isocyanato-2-(isocyanatocarbamoyl)octanoyl]amino]hexyl]carbamate |
| SMILES | COC(=O)NCCCCCCNC(=O)C(CCCCCCN=C=O)C(=O)NN=C=O |
| InChI | InChI=1S/C19H31N5O6/c1-30-19(29)22-13-9-5-4-8-12-21-17(27)16(18(28)24-23-15-26)10-6-2-3-7-11-20-14-25/h16H,2-13H2,1H3,(H,21,27)(H,22,29)(H,24,28) |
| InChIKey | HNNZYUWKSNGMQC-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 155.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|