C10H19N3O3 — CID 134398370
2-(dimethylamino)ethyl N-(4-isocyanatobutyl)carbamate (PubChem CID 134398370) has the molecular formula C10H19N3O3 and a molecular weight of 229.28 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl N-(4-isocyanatobutyl)carbamate.
| Compound Name | 2-(dimethylamino)ethyl N-(4-isocyanatobutyl)carbamate |
|---|---|
| PubChem CID | 134398370 |
| Molecular Formula | C10H19N3O3 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.14 |
| IUPAC Name | 2-(dimethylamino)ethyl N-(4-isocyanatobutyl)carbamate |
| SMILES | CN(C)CCOC(=O)NCCCCN=C=O |
| InChI | InChI=1S/C10H19N3O3/c1-13(2)7-8-16-10(15)12-6-4-3-5-11-9-14/h3-8H2,1-2H3,(H,12,15) |
| InChIKey | JELDMBARJCJOJM-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|