C17H27N3O6 — CID 159358632
2-(6-cyanatohexylcarbamoyloxy)ethyl 6-isocyanatohexanoate (PubChem CID 159358632) has the molecular formula C17H27N3O6 and a molecular weight of 369.42 g/mol. Its IUPAC name is 2-(6-cyanatohexylcarbamoyloxy)ethyl 6-isocyanatohexanoate.
| Compound Name | 2-(6-cyanatohexylcarbamoyloxy)ethyl 6-isocyanatohexanoate |
|---|---|
| PubChem CID | 159358632 |
| Molecular Formula | C17H27N3O6 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | 2-(6-cyanatohexylcarbamoyloxy)ethyl 6-isocyanatohexanoate |
| SMILES | N#COCCCCCCNC(=O)OCCOC(=O)CCCCCN=C=O |
| InChI | InChI=1S/C17H27N3O6/c18-14-24-11-7-2-1-6-10-20-17(23)26-13-12-25-16(22)8-4-3-5-9-19-15-21/h1-13H2,(H,20,23) |
| InChIKey | DQBKXHSIALUQSA-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 127.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|