C49H76N10O11 — CID 157477355
6-[3,5-bis(6-isocyanatohexyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]hexyl cyanate;6-[bis(8-isocyanatooctanoyl)amino]hexyl cyanate (PubChem CID 157477355) has the molecular formula C49H76N10O11 and a molecular weight of 981.21 g/mol. Its IUPAC name is 6-[3,5-bis(6-isocyanatohexyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]hexyl cyanate;6-[bis(8-isocyanatooctanoyl)amino]hexyl cyanate.
| Compound Name | 6-[3,5-bis(6-isocyanatohexyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]hexyl cyanate;6-[bis(8-isocyanatooctanoyl)amino]hexyl cyanate |
|---|---|
| PubChem CID | 157477355 |
| Molecular Formula | C49H76N10O11 |
| Molecular Weight | 981.21 g/mol |
| Exact Mass | 980.57 |
| IUPAC Name | 6-[3,5-bis(6-isocyanatohexyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]hexyl cyanate;6-[bis(8-isocyanatooctanoyl)amino]hexyl cyanate |
| SMILES | N#COCCCCCCN(C(=O)CCCCCCCN=C=O)C(=O)CCCCCCCN=C=O.N#COCCCCCCn1c(=O)n(CCCCCCN=C=O)c(=O)n(CCCCCCN=C=O)c1=O |
| InChI | InChI=1S/C25H40N4O5.C24H36N6O6/c26-21-34-20-14-8-7-13-19-29(24(32)15-9-3-1-5-11-17-27-22-30)25(33)16-10-4-2-6-12-18-28-23-31;25-19-36-18-12-6-5-11-17-30-23(34)28(15-9-3-1-7-13-26-20-31)22(33)29(24(30)35)16-10-4-2-8-14-27-21-32/h1-20H2;1-18H2 |
| InChIKey | BVTGIXFHFMFNEC-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 287.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 70 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 981.21 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|