About 2-prop-2-enoyloxyethyl 7-cyanatoheptanoate
2-prop-2-enoyloxyethyl 7-cyanatoheptanoate (PubChem CID 129107802) has the molecular formula C13H19NO5
and a molecular weight of 269.30 g/mol. Its IUPAC name is 2-prop-2-enoyloxyethyl 7-cyanatoheptanoate.
Molecular Properties
| Compound Name | 2-prop-2-enoyloxyethyl 7-cyanatoheptanoate |
| PubChem CID | 129107802 |
| Molecular Formula | C13H19NO5 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 2-prop-2-enoyloxyethyl 7-cyanatoheptanoate |
| SMILES | C=CC(=O)OCCOC(=O)CCCCCCOC#N |
| InChI | InChI=1S/C13H19NO5/c1-2-12(15)18-9-10-19-13(16)7-5-3-4-6-8-17-11-14/h2H,1,3-10H2 |
| InChIKey | IYZBVUMINSGSNN-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 85.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-prop-2-enoyloxyethyl 7-cyanatoheptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-prop-2-enoyloxyethyl 7-cyanatoheptanoate?
The IUPAC name of 2-prop-2-enoyloxyethyl 7-cyanatoheptanoate (CID 129107802) is 2-prop-2-enoyloxyethyl 7-cyanatoheptanoate.
What is the SMILES notation for 2-prop-2-enoyloxyethyl 7-cyanatoheptanoate?
The canonical SMILES for 2-prop-2-enoyloxyethyl 7-cyanatoheptanoate is C=CC(=O)OCCOC(=O)CCCCCCOC#N.
What is the InChIKey of 2-prop-2-enoyloxyethyl 7-cyanatoheptanoate?
The InChIKey is IYZBVUMINSGSNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO5/c1-2-12(15)18-9-10-19-13(16)7-5-3-4-6-8-17-11-14/h2H,1,3-10H2.
What are the key properties of 2-prop-2-enoyloxyethyl 7-cyanatoheptanoate?
2-prop-2-enoyloxyethyl 7-cyanatoheptanoate has a molecular weight of 269.30 g/mol, XLogP of 1.71, 11 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-prop-2-enoyloxyethyl 7-cyanatoheptanoate is sourced from PubChem (CID 129107802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).