About 2-prop-2-enoyloxyethyl 6-cyanatohexanoate
2-prop-2-enoyloxyethyl 6-cyanatohexanoate (PubChem CID 129129909) has the molecular formula C12H17NO5
and a molecular weight of 255.27 g/mol. Its IUPAC name is 2-prop-2-enoyloxyethyl 6-cyanatohexanoate.
Molecular Properties
| Compound Name | 2-prop-2-enoyloxyethyl 6-cyanatohexanoate |
| PubChem CID | 129129909 |
| Molecular Formula | C12H17NO5 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 2-prop-2-enoyloxyethyl 6-cyanatohexanoate |
| SMILES | C=CC(=O)OCCOC(=O)CCCCCOC#N |
| InChI | InChI=1S/C12H17NO5/c1-2-11(14)17-8-9-18-12(15)6-4-3-5-7-16-10-13/h2H,1,3-9H2 |
| InChIKey | WUTLAZAWDGRGLR-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 85.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-prop-2-enoyloxyethyl 6-cyanatohexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-prop-2-enoyloxyethyl 6-cyanatohexanoate?
The IUPAC name of 2-prop-2-enoyloxyethyl 6-cyanatohexanoate (CID 129129909) is 2-prop-2-enoyloxyethyl 6-cyanatohexanoate.
What is the SMILES notation for 2-prop-2-enoyloxyethyl 6-cyanatohexanoate?
The canonical SMILES for 2-prop-2-enoyloxyethyl 6-cyanatohexanoate is C=CC(=O)OCCOC(=O)CCCCCOC#N.
What is the InChIKey of 2-prop-2-enoyloxyethyl 6-cyanatohexanoate?
The InChIKey is WUTLAZAWDGRGLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO5/c1-2-11(14)17-8-9-18-12(15)6-4-3-5-7-16-10-13/h2H,1,3-9H2.
What are the key properties of 2-prop-2-enoyloxyethyl 6-cyanatohexanoate?
2-prop-2-enoyloxyethyl 6-cyanatohexanoate has a molecular weight of 255.27 g/mol, XLogP of 1.32, 10 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-prop-2-enoyloxyethyl 6-cyanatohexanoate is sourced from PubChem (CID 129129909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).