C20H33N5O6 — CID 121277798
[2-(7-isocyanatoheptylamino)-2-oxoethyl] N-[7-(carbonisocyanatidoylamino)heptyl]carbamate (PubChem CID 121277798) has the molecular formula C20H33N5O6 and a molecular weight of 439.51 g/mol. Its IUPAC name is [2-(7-isocyanatoheptylamino)-2-oxoethyl] N-[7-(carbonisocyanatidoylamino)heptyl]carbamate.
| Compound Name | [2-(7-isocyanatoheptylamino)-2-oxoethyl] N-[7-(carbonisocyanatidoylamino)heptyl]carbamate |
|---|---|
| PubChem CID | 121277798 |
| Molecular Formula | C20H33N5O6 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.24 |
| IUPAC Name | [2-(7-isocyanatoheptylamino)-2-oxoethyl] N-[7-(carbonisocyanatidoylamino)heptyl]carbamate |
| SMILES | O=C=NCCCCCCCNC(=O)COC(=O)NCCCCCCCNC(=O)N=C=O |
| InChI | InChI=1S/C20H33N5O6/c26-16-21-11-7-3-1-4-8-12-22-18(28)15-31-20(30)24-14-10-6-2-5-9-13-23-19(29)25-17-27/h1-15H2,(H,22,28)(H,23,29)(H,24,30) |
| InChIKey | GKCSQNXYBAIZQV-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 155.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|