C30H52N6O9 — CID 145055399
2,2-bis(6-isocyanatohexylcarbamoyloxymethyl)butyl N-(6-formamidohexyl)carbamate (PubChem CID 145055399) has the molecular formula C30H52N6O9 and a molecular weight of 640.78 g/mol. Its IUPAC name is 2,2-bis(6-isocyanatohexylcarbamoyloxymethyl)butyl N-(6-formamidohexyl)carbamate.
| Compound Name | 2,2-bis(6-isocyanatohexylcarbamoyloxymethyl)butyl N-(6-formamidohexyl)carbamate |
|---|---|
| PubChem CID | 145055399 |
| Molecular Formula | C30H52N6O9 |
| Molecular Weight | 640.78 g/mol |
| Exact Mass | 640.38 |
| IUPAC Name | 2,2-bis(6-isocyanatohexylcarbamoyloxymethyl)butyl N-(6-formamidohexyl)carbamate |
| SMILES | CCC(COC(=O)NCCCCCCN=C=O)(COC(=O)NCCCCCCN=C=O)COC(=O)NCCCCCCNC=O |
| InChI | InChI=1S/C30H52N6O9/c1-2-30(21-43-27(40)34-18-12-6-3-9-15-31-24-37,22-44-28(41)35-19-13-7-4-10-16-32-25-38)23-45-29(42)36-20-14-8-5-11-17-33-26-39/h24H,2-23H2,1H3,(H,31,37)(H,34,40)(H,35,41)(H,36,42) |
| InChIKey | RRRJTYAXWMPJSR-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 202.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.78 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|