C47H60N2O20 — CID 159664397
1,6-diisocyanatohexane;[3-prop-2-enoyloxy-2,2-bis[[3-prop-2-enoyloxy-2,2-bis(prop-2-enoyloxymethyl)propoxy]methyl]propyl] prop-2-enoate (PubChem CID 159664397) has the molecular formula C47H60N2O20 and a molecular weight of 972.99 g/mol. Its IUPAC name is 1,6-diisocyanatohexane;[3-prop-2-enoyloxy-2,2-bis[[3-prop-2-enoyloxy-2,2-bis(prop-2-enoyloxymethyl)propoxy]methyl]propyl] prop-2-enoate.
| Compound Name | 1,6-diisocyanatohexane;[3-prop-2-enoyloxy-2,2-bis[[3-prop-2-enoyloxy-2,2-bis(prop-2-enoyloxymethyl)propoxy]methyl]propyl] prop-2-enoate |
|---|---|
| PubChem CID | 159664397 |
| Molecular Formula | C47H60N2O20 |
| Molecular Weight | 972.99 g/mol |
| Exact Mass | 972.37 |
| IUPAC Name | 1,6-diisocyanatohexane;[3-prop-2-enoyloxy-2,2-bis[[3-prop-2-enoyloxy-2,2-bis(prop-2-enoyloxymethyl)propoxy]methyl]propyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(COCC(COC(=O)C=C)(COC(=O)C=C)COC(=O)C=C)(COCC(COC(=O)C=C)(COC(=O)C=C)COC(=O)C=C)COC(=O)C=C.O=C=NCCCCCCN=C=O |
| InChI | InChI=1S/C39H48O18.C8H12N2O2/c1-9-29(40)50-21-37(22-51-30(41)10-2,17-48-19-38(23-52-31(42)11-3,24-53-32(43)12-4)25-54-33(44)13-5)18-49-20-39(26-55-34(45)14-6,27-56-35(46)15-7)28-57-36(47)16-8;11-7-9-5-3-1-2-4-6-10-8-12/h9-16H,1-8,17-28H2;1-6H2 |
| InChIKey | MTFHGMAAXVLKOY-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 287.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 22 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 972.99 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 22 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|