About 1-carbamoyloxyethyl prop-2-enoate;1-isocyanatohexane
1-carbamoyloxyethyl prop-2-enoate;1-isocyanatohexane (PubChem CID 87570156) has the molecular formula C13H22N2O5
and a molecular weight of 286.33 g/mol. Its IUPAC name is 1-carbamoyloxyethyl prop-2-enoate;1-isocyanatohexane.
Molecular Properties
| Compound Name | 1-carbamoyloxyethyl prop-2-enoate;1-isocyanatohexane |
| PubChem CID | 87570156 |
| Molecular Formula | C13H22N2O5 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 1-carbamoyloxyethyl prop-2-enoate;1-isocyanatohexane |
| SMILES | C=CC(=O)OC(C)OC(N)=O.CCCCCCN=C=O |
| InChI | InChI=1S/C7H13NO.C6H9NO4/c1-2-3-4-5-6-8-7-9;1-3-5(8)10-4(2)11-6(7)9/h2-6H2,1H3;3-4H,1H2,2H3,(H2,7,9) |
| InChIKey | JKOYUVCDHBAAJU-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-carbamoyloxyethyl prop-2-enoate;1-isocyanatohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-carbamoyloxyethyl prop-2-enoate;1-isocyanatohexane?
The IUPAC name of 1-carbamoyloxyethyl prop-2-enoate;1-isocyanatohexane (CID 87570156) is 1-carbamoyloxyethyl prop-2-enoate;1-isocyanatohexane.
What is the SMILES notation for 1-carbamoyloxyethyl prop-2-enoate;1-isocyanatohexane?
The canonical SMILES for 1-carbamoyloxyethyl prop-2-enoate;1-isocyanatohexane is C=CC(=O)OC(C)OC(N)=O.CCCCCCN=C=O.
What is the InChIKey of 1-carbamoyloxyethyl prop-2-enoate;1-isocyanatohexane?
The InChIKey is JKOYUVCDHBAAJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO.C6H9NO4/c1-2-3-4-5-6-8-7-9;1-3-5(8)10-4(2)11-6(7)9/h2-6H2,1H3;3-4H,1H2,2H3,(H2,7,9).
What are the key properties of 1-carbamoyloxyethyl prop-2-enoate;1-isocyanatohexane?
1-carbamoyloxyethyl prop-2-enoate;1-isocyanatohexane has a molecular weight of 286.33 g/mol, XLogP of 2.06, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-carbamoyloxyethyl prop-2-enoate;1-isocyanatohexane is sourced from PubChem (CID 87570156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).