C20H34N4O6S2 — CID 59502567
2-[2-(6-isocyanatohexylcarbamoyloxy)ethyldisulfanyl]ethyl N-(6-isocyanatohexyl)carbamate (PubChem CID 59502567) has the molecular formula C20H34N4O6S2 and a molecular weight of 490.65 g/mol. Its IUPAC name is 2-[2-(6-isocyanatohexylcarbamoyloxy)ethyldisulfanyl]ethyl N-(6-isocyanatohexyl)carbamate.
| Compound Name | 2-[2-(6-isocyanatohexylcarbamoyloxy)ethyldisulfanyl]ethyl N-(6-isocyanatohexyl)carbamate |
|---|---|
| PubChem CID | 59502567 |
| Molecular Formula | C20H34N4O6S2 |
| Molecular Weight | 490.65 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | 2-[2-(6-isocyanatohexylcarbamoyloxy)ethyldisulfanyl]ethyl N-(6-isocyanatohexyl)carbamate |
| SMILES | O=C=NCCCCCCNC(=O)OCCSSCCOC(=O)NCCCCCCN=C=O |
| InChI | InChI=1S/C20H34N4O6S2/c25-17-21-9-5-1-3-7-11-23-19(27)29-13-15-31-32-16-14-30-20(28)24-12-8-4-2-6-10-22-18-26/h1-16H2,(H,23,27)(H,24,28) |
| InChIKey | OGGOKRORKYGEEZ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 135.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.65 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|