C21H27N3O10 — CID 22892435
2-[[1-(2-methylprop-2-enoyloxy)-3-prop-2-enoyloxypropan-2-yl]oxycarbonylamino]ethyl 2,6-diisocyanatohexanoate (PubChem CID 22892435) has the molecular formula C21H27N3O10 and a molecular weight of 481.46 g/mol. Its IUPAC name is 2-[[1-(2-methylprop-2-enoyloxy)-3-prop-2-enoyloxypropan-2-yl]oxycarbonylamino]ethyl 2,6-diisocyanatohexanoate.
| Compound Name | 2-[[1-(2-methylprop-2-enoyloxy)-3-prop-2-enoyloxypropan-2-yl]oxycarbonylamino]ethyl 2,6-diisocyanatohexanoate |
|---|---|
| PubChem CID | 22892435 |
| Molecular Formula | C21H27N3O10 |
| Molecular Weight | 481.46 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | 2-[[1-(2-methylprop-2-enoyloxy)-3-prop-2-enoyloxypropan-2-yl]oxycarbonylamino]ethyl 2,6-diisocyanatohexanoate |
| SMILES | C=CC(=O)OCC(COC(=O)C(=C)C)OC(=O)NCCOC(=O)C(CCCCN=C=O)N=C=O |
| InChI | InChI=1S/C21H27N3O10/c1-4-18(27)32-11-16(12-33-19(28)15(2)3)34-21(30)23-9-10-31-20(29)17(24-14-26)7-5-6-8-22-13-25/h4,16-17H,1-2,5-12H2,3H3,(H,23,30) |
| InChIKey | GRRLDLJMKWDCCS-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 176.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.46 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|