C24H42N2O9 — CID 159841339
butan-2-ol;2-(5-hydroxyhexan-3-yloxycarbonylamino)ethyl 2-methylprop-2-enoate;2-isocyanatoethyl 2-methylprop-2-enoate (PubChem CID 159841339) has the molecular formula C24H42N2O9 and a molecular weight of 502.61 g/mol. Its IUPAC name is butan-2-ol;2-(5-hydroxyhexan-3-yloxycarbonylamino)ethyl 2-methylprop-2-enoate;2-isocyanatoethyl 2-methylprop-2-enoate.
| Compound Name | butan-2-ol;2-(5-hydroxyhexan-3-yloxycarbonylamino)ethyl 2-methylprop-2-enoate;2-isocyanatoethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 159841339 |
| Molecular Formula | C24H42N2O9 |
| Molecular Weight | 502.61 g/mol |
| Exact Mass | 502.29 |
| IUPAC Name | butan-2-ol;2-(5-hydroxyhexan-3-yloxycarbonylamino)ethyl 2-methylprop-2-enoate;2-isocyanatoethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCN=C=O.C=C(C)C(=O)OCCNC(=O)OC(CC)CC(C)O.CCC(C)O |
| InChI | InChI=1S/C13H23NO5.C7H9NO3.C4H10O/c1-5-11(8-10(4)15)19-13(17)14-6-7-18-12(16)9(2)3;1-6(2)7(10)11-4-3-8-5-9;1-3-4(2)5/h10-11,15H,2,5-8H2,1,3-4H3,(H,14,17);1,3-4H2,2H3;4-5H,3H2,1-2H3 |
| InChIKey | NOSDWSLMWYPLHL-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 160.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.61 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|