C16H27NO7 — CID 169077980
2-[(3-acetyloxy-5-hydroxyheptoxy)carbonylamino]ethyl 2-methylprop-2-enoate (PubChem CID 169077980) has the molecular formula C16H27NO7 and a molecular weight of 345.39 g/mol. Its IUPAC name is 2-[(3-acetyloxy-5-hydroxyheptoxy)carbonylamino]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[(3-acetyloxy-5-hydroxyheptoxy)carbonylamino]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 169077980 |
| Molecular Formula | C16H27NO7 |
| Molecular Weight | 345.39 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | 2-[(3-acetyloxy-5-hydroxyheptoxy)carbonylamino]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCNC(=O)OCCC(CC(O)CC)OC(C)=O |
| InChI | InChI=1S/C16H27NO7/c1-5-13(19)10-14(24-12(4)18)6-8-23-16(21)17-7-9-22-15(20)11(2)3/h13-14,19H,2,5-10H2,1,3-4H3,(H,17,21) |
| InChIKey | SKLXSLVEKMMMAM-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.39 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|