About (3-acetyloxy-5-hydroxyheptyl) 4-(2-methylprop-2-enoyloxy)butanoate;methane
(3-acetyloxy-5-hydroxyheptyl) 4-(2-methylprop-2-enoyloxy)butanoate;methane (PubChem CID 161342054) has the molecular formula C24H56O7
and a molecular weight of 456.71 g/mol. Its IUPAC name is (3-acetyloxy-5-hydroxyheptyl) 4-(2-methylprop-2-enoyloxy)butanoate;methane.
Molecular Properties
| Compound Name | (3-acetyloxy-5-hydroxyheptyl) 4-(2-methylprop-2-enoyloxy)butanoate;methane |
| PubChem CID | 161342054 |
| Molecular Formula | C24H56O7 |
| Molecular Weight | 456.71 g/mol |
| Exact Mass | 456.40 |
| IUPAC Name | (3-acetyloxy-5-hydroxyheptyl) 4-(2-methylprop-2-enoyloxy)butanoate;methane |
| SMILES | C.C.C.C.C.C.C.C=C(C)C(=O)OCCCC(=O)OCCC(CC(O)CC)OC(C)=O |
| InChI | InChI=1S/C17H28O7.7CH4/c1-5-14(19)11-15(24-13(4)18)8-10-22-16(20)7-6-9-23-17(21)12(2)3;;;;;;;/h14-15,19H,2,5-11H2,1,3-4H3;7*1H4 |
| InChIKey | VMUJTHSLPDOCLX-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 456.71 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (3-acetyloxy-5-hydroxyheptyl) 4-(2-methylprop-2-enoyloxy)butanoate;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-acetyloxy-5-hydroxyheptyl) 4-(2-methylprop-2-enoyloxy)butanoate;methane?
The IUPAC name of (3-acetyloxy-5-hydroxyheptyl) 4-(2-methylprop-2-enoyloxy)butanoate;methane (CID 161342054) is (3-acetyloxy-5-hydroxyheptyl) 4-(2-methylprop-2-enoyloxy)butanoate;methane.
What is the SMILES notation for (3-acetyloxy-5-hydroxyheptyl) 4-(2-methylprop-2-enoyloxy)butanoate;methane?
The canonical SMILES for (3-acetyloxy-5-hydroxyheptyl) 4-(2-methylprop-2-enoyloxy)butanoate;methane is C.C.C.C.C.C.C.C=C(C)C(=O)OCCCC(=O)OCCC(CC(O)CC)OC(C)=O.
What is the InChIKey of (3-acetyloxy-5-hydroxyheptyl) 4-(2-methylprop-2-enoyloxy)butanoate;methane?
The InChIKey is VMUJTHSLPDOCLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28O7.7CH4/c1-5-14(19)11-15(24-13(4)18)8-10-22-16(20)7-6-9-23-17(21)12(2)3;;;;;;;/h14-15,19H,2,5-11H2,1,3-4H3;7*1H4.
What are the key properties of (3-acetyloxy-5-hydroxyheptyl) 4-(2-methylprop-2-enoyloxy)butanoate;methane?
(3-acetyloxy-5-hydroxyheptyl) 4-(2-methylprop-2-enoyloxy)butanoate;methane has a molecular weight of 456.71 g/mol, XLogP of 6.36, 12 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (3-acetyloxy-5-hydroxyheptyl) 4-(2-methylprop-2-enoyloxy)butanoate;methane is sourced from PubChem (CID 161342054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).