C13H17NO5 — CID 154337142
[4-isocyanato-3-(2-methylprop-2-enoyloxy)butyl] 2-methylprop-2-enoate (PubChem CID 154337142) has the molecular formula C13H17NO5 and a molecular weight of 267.28 g/mol. Its IUPAC name is [4-isocyanato-3-(2-methylprop-2-enoyloxy)butyl] 2-methylprop-2-enoate.
| Compound Name | [4-isocyanato-3-(2-methylprop-2-enoyloxy)butyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 154337142 |
| Molecular Formula | C13H17NO5 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | [4-isocyanato-3-(2-methylprop-2-enoyloxy)butyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC(CN=C=O)OC(=O)C(=C)C |
| InChI | InChI=1S/C13H17NO5/c1-9(2)12(16)18-6-5-11(7-14-8-15)19-13(17)10(3)4/h11H,1,3,5-7H2,2,4H3 |
| InChIKey | WVZKWHWXFGGBCR-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 82.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|