C22H35N3O8 — CID 22892452
2-[3-[2-[[7-isocyanato-4-(isocyanatomethyl)heptyl]carbamoyloxy]ethoxy]propoxy]ethyl 2-methylprop-2-enoate (PubChem CID 22892452) has the molecular formula C22H35N3O8 and a molecular weight of 469.54 g/mol. Its IUPAC name is 2-[3-[2-[[7-isocyanato-4-(isocyanatomethyl)heptyl]carbamoyloxy]ethoxy]propoxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[3-[2-[[7-isocyanato-4-(isocyanatomethyl)heptyl]carbamoyloxy]ethoxy]propoxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 22892452 |
| Molecular Formula | C22H35N3O8 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.24 |
| IUPAC Name | 2-[3-[2-[[7-isocyanato-4-(isocyanatomethyl)heptyl]carbamoyloxy]ethoxy]propoxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOCCCOCCOC(=O)NCCCC(CCCN=C=O)CN=C=O |
| InChI | InChI=1S/C22H35N3O8/c1-19(2)21(28)32-14-12-30-10-5-11-31-13-15-33-22(29)25-9-4-7-20(16-24-18-27)6-3-8-23-17-26/h20H,1,3-16H2,2H3,(H,25,29) |
| InChIKey | AUNXUVFTCKSIFC-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 141.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|