C16H25N3O6 — CID 22892479
2-prop-2-enylperoxyethyl N-[7-isocyanato-4-(isocyanatomethyl)heptyl]carbamate (PubChem CID 22892479) has the molecular formula C16H25N3O6 and a molecular weight of 355.39 g/mol. Its IUPAC name is 2-prop-2-enylperoxyethyl N-[7-isocyanato-4-(isocyanatomethyl)heptyl]carbamate.
| Compound Name | 2-prop-2-enylperoxyethyl N-[7-isocyanato-4-(isocyanatomethyl)heptyl]carbamate |
|---|---|
| PubChem CID | 22892479 |
| Molecular Formula | C16H25N3O6 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | 2-prop-2-enylperoxyethyl N-[7-isocyanato-4-(isocyanatomethyl)heptyl]carbamate |
| SMILES | C=CCOOCCOC(=O)NCCCC(CCCN=C=O)CN=C=O |
| InChI | InChI=1S/C16H25N3O6/c1-2-9-24-25-11-10-23-16(22)19-8-4-6-15(12-18-14-21)5-3-7-17-13-20/h2,15H,1,3-12H2,(H,19,22) |
| InChIKey | HZZRYSRKFPJIRI-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 115.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|