C10H14N2O4 — CID 88645522
(3-carbamoyloxy-4-cyanobutyl) 2-methylprop-2-enoate (PubChem CID 88645522) has the molecular formula C10H14N2O4 and a molecular weight of 226.23 g/mol. Its IUPAC name is (3-carbamoyloxy-4-cyanobutyl) 2-methylprop-2-enoate.
| Compound Name | (3-carbamoyloxy-4-cyanobutyl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 88645522 |
| Molecular Formula | C10H14N2O4 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | (3-carbamoyloxy-4-cyanobutyl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC(CC#N)OC(N)=O |
| InChI | InChI=1S/C10H14N2O4/c1-7(2)9(13)15-6-4-8(3-5-11)16-10(12)14/h8H,1,3-4,6H2,2H3,(H2,12,14) |
| InChIKey | DMAZVMRUNPWOFS-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 102.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|