C9H14ClNO3 — CID 86736886
[4-amino-3-(chloromethyl)-4-oxobutyl] 2-methylprop-2-enoate (PubChem CID 86736886) has the molecular formula C9H14ClNO3 and a molecular weight of 219.67 g/mol. Its IUPAC name is [4-amino-3-(chloromethyl)-4-oxobutyl] 2-methylprop-2-enoate.
| Compound Name | [4-amino-3-(chloromethyl)-4-oxobutyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 86736886 |
| Molecular Formula | C9H14ClNO3 |
| Molecular Weight | 219.67 g/mol |
| Exact Mass | 219.07 |
| IUPAC Name | [4-amino-3-(chloromethyl)-4-oxobutyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC(CCl)C(N)=O |
| InChI | InChI=1S/C9H14ClNO3/c1-6(2)9(13)14-4-3-7(5-10)8(11)12/h7H,1,3-5H2,2H3,(H2,11,12) |
| InChIKey | IVBPMVQODZKHNS-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.67 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|