C8H15O5P — CID 87771040
4-(2-methylprop-2-enoyloxy)butan-2-ylphosphonic acid (PubChem CID 87771040) has the molecular formula C8H15O5P and a molecular weight of 222.18 g/mol. Its IUPAC name is 4-(2-methylprop-2-enoyloxy)butan-2-ylphosphonic acid.
| Compound Name | 4-(2-methylprop-2-enoyloxy)butan-2-ylphosphonic acid |
|---|---|
| PubChem CID | 87771040 |
| Molecular Formula | C8H15O5P |
| Molecular Weight | 222.18 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | 4-(2-methylprop-2-enoyloxy)butan-2-ylphosphonic acid |
| SMILES | C=C(C)C(=O)OCCC(C)P(=O)(O)O |
| InChI | InChI=1S/C8H15O5P/c1-6(2)8(9)13-5-4-7(3)14(10,11)12/h7H,1,4-5H2,2-3H3,(H2,10,11,12) |
| InChIKey | IMBQPQBPXLHNCT-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.18 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|