C14H18O6 — CID 174764776
2-methylidene-3,5-bis(2-methylprop-2-enoyloxy)pentanoic acid (PubChem CID 174764776) has the molecular formula C14H18O6 and a molecular weight of 282.29 g/mol. Its IUPAC name is 2-methylidene-3,5-bis(2-methylprop-2-enoyloxy)pentanoic acid.
| Compound Name | 2-methylidene-3,5-bis(2-methylprop-2-enoyloxy)pentanoic acid |
|---|---|
| PubChem CID | 174764776 |
| Molecular Formula | C14H18O6 |
| Molecular Weight | 282.29 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 2-methylidene-3,5-bis(2-methylprop-2-enoyloxy)pentanoic acid |
| SMILES | C=C(C)C(=O)OCCC(OC(=O)C(=C)C)C(=C)C(=O)O |
| InChI | InChI=1S/C14H18O6/c1-8(2)13(17)19-7-6-11(10(5)12(15)16)20-14(18)9(3)4/h11H,1,3,5-7H2,2,4H3,(H,15,16) |
| InChIKey | ZGRAHRJWQLMMNL-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.29 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|